C44H38BF10OP — CID 139122173
(1R,2S,5S,7R,8S)-3,3-bis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-6,6-bis(2,4,6-trimethylphenyl)-4-oxa-6-phosphonia-3-boranuidatricyclo[6.2.1.02,7]undecane (PubChem CID 139122173) has the molecular formula C44H38BF10OP and a molecular weight of 814.55 g/mol. Its IUPAC name is (1R,2S,5S,7R,8S)-3,3-bis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-6,6-bis(2,4,6-trimethylphenyl)-4-oxa-6-phosphonia-3-boranuidatricyclo[6.2.1.02,7]undecane.
| Compound Name | (1R,2S,5S,7R,8S)-3,3-bis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-6,6-bis(2,4,6-trimethylphenyl)-4-oxa-6-phosphonia-3-boranuidatricyclo[6.2.1.02,7]undecane |
|---|---|
| PubChem CID | 139122173 |
| Molecular Formula | C44H38BF10OP |
| Molecular Weight | 814.55 g/mol |
| Exact Mass | 814.26 |
| IUPAC Name | (1R,2S,5S,7R,8S)-3,3-bis(2,3,4,5,6-pentafluorophenyl)-5-phenyl-6,6-bis(2,4,6-trimethylphenyl)-4-oxa-6-phosphonia-3-boranuidatricyclo[6.2.1.02,7]undecane |
| SMILES | Cc1cc(C)c([P+]2(c3c(C)cc(C)cc3C)[C@H]3[C@H]4CC[C@H](C4)[C@@H]3[B-](c3c(F)c(F)c(F)c(F)c3F)(c3c(F)c(F)c(F)c(F)c3F)O[C@@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C44H38BF10OP/c1-19-14-21(3)41(22(4)15-19)57(42-23(5)16-20(2)17-24(42)6)43-27-13-12-26(18-27)28(43)45(56-44(57)25-10-8-7-9-11-25,29-31(46)35(50)39(54)36(51)32(29)47)30-33(48)37(52)40(55)38(53)34(30)49/h7-11,14-17,26-28,43-44H,12-13,18H2,1-6H3/t26-,27+,28+,43+,44+/m1/s1 |
| InChIKey | GZCBMIWQOGYBLC-QJEFOTBKSA-N |
| XLogP | 10.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.55 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|