C56H64N8 — CID 139122218
1-butyl-3-[4-[2,3,4-tris[4-(3-butyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]cyclobutyl]phenyl]-2H-imidazol-1-ium-2-ide (PubChem CID 139122218) has the molecular formula C56H64N8 and a molecular weight of 849.18 g/mol. Its IUPAC name is 1-butyl-3-[4-[2,3,4-tris[4-(3-butyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]cyclobutyl]phenyl]-2H-imidazol-1-ium-2-ide.
| Compound Name | 1-butyl-3-[4-[2,3,4-tris[4-(3-butyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]cyclobutyl]phenyl]-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 139122218 |
| Molecular Formula | C56H64N8 |
| Molecular Weight | 849.18 g/mol |
| Exact Mass | 848.53 |
| IUPAC Name | 1-butyl-3-[4-[2,3,4-tris[4-(3-butyl-2H-imidazol-3-ium-2-id-1-yl)phenyl]cyclobutyl]phenyl]-2H-imidazol-1-ium-2-ide |
| SMILES | CCCC[n+]1[c-]n(-c2ccc(C3C(c4ccc(-n5[c-][n+](CCCC)cc5)cc4)C(c4ccc(-n5[c-][n+](CCCC)cc5)cc4)C3c3ccc(-n4[c-][n+](CCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H64N8/c1-5-9-29-57-33-37-61(41-57)49-21-13-45(14-22-49)53-54(46-15-23-50(24-16-46)62-38-34-58(42-62)30-10-6-2)56(48-19-27-52(28-20-48)64-40-36-60(44-64)32-12-8-4)55(53)47-17-25-51(26-18-47)63-39-35-59(43-63)31-11-7-3/h13-28,33-40,53-56H,5-12,29-32H2,1-4H3 |
| InChIKey | IBRSWZVATYUJNG-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 35.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.18 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|