C4H8N10O8 — CID 139122239
hydroxyazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole (PubChem CID 139122239) has the molecular formula C4H8N10O8 and a molecular weight of 324.17 g/mol. Its IUPAC name is hydroxyazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole.
| Compound Name | hydroxyazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole |
|---|---|
| PubChem CID | 139122239 |
| Molecular Formula | C4H8N10O8 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | hydroxyazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(-c2nc([N+](=O)[O-])nn2[O-])n([O-])n1.[NH3+]O.[NH3+]O |
| InChI | InChI=1S/C4N8O6.2H4NO/c13-9-1(5-3(7-9)11(15)16)2-6-4(12(17)18)8-10(2)14;2*1-2/h;2*2H,1H3/q-2;2*+1 |
| InChIKey | NBLZKUPKHGHSPQ-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 289.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|