C4H12N10O8 — CID 139122241
diazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole;dihydrate (PubChem CID 139122241) has the molecular formula C4H12N10O8 and a molecular weight of 328.20 g/mol. Its IUPAC name is diazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole;dihydrate.
| Compound Name | diazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole;dihydrate |
|---|---|
| PubChem CID | 139122241 |
| Molecular Formula | C4H12N10O8 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | diazanium;3-nitro-5-(5-nitro-2-oxido-1,2,4-triazol-3-yl)-1-oxido-1,2,4-triazole;dihydrate |
| SMILES | O.O.O=[N+]([O-])c1nc(-c2nc([N+](=O)[O-])nn2[O-])n([O-])n1.[NH4+].[NH4+] |
| InChI | InChI=1S/C4N8O6.2H3N.2H2O/c13-9-1(5-3(7-9)11(15)16)2-6-4(12(17)18)8-10(2)14;;;;/h;2*1H3;2*1H2/q-2;;;;/p+2 |
| InChIKey | KRAJHQRTUSWQGC-UHFFFAOYSA-P |
| XLogP | -1.85 |
| TPSA | 329.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|