C27H25N3O4S — CID 139122251
(NE)-N-[(8S,9S,13R,15S)-8-hydroxy-8-methyl-14-oxo-13-phenyl-1,12-diazatetracyclo[7.5.1.02,7.012,15]pentadeca-2,4,6-trien-11-ylidene]-4-methylbenzenesulfonamide (PubChem CID 139122251) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is (NE)-N-[(8S,9S,13R,15S)-8-hydroxy-8-methyl-14-oxo-13-phenyl-1,12-diazatetracyclo[7.5.1.02,7.012,15]pentadeca-2,4,6-trien-11-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[(8S,9S,13R,15S)-8-hydroxy-8-methyl-14-oxo-13-phenyl-1,12-diazatetracyclo[7.5.1.02,7.012,15]pentadeca-2,4,6-trien-11-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 139122251 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (NE)-N-[(8S,9S,13R,15S)-8-hydroxy-8-methyl-14-oxo-13-phenyl-1,12-diazatetracyclo[7.5.1.02,7.012,15]pentadeca-2,4,6-trien-11-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2\C[C@H]3[C@@H]4N(C(=O)[C@@H](c5ccccc5)N24)c2ccccc2[C@@]3(C)O)cc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-17-12-14-19(15-13-17)35(33,34)28-23-16-21-25-29(22-11-7-6-10-20(22)27(21,2)32)26(31)24(30(23)25)18-8-4-3-5-9-18/h3-15,21,24-25,32H,16H2,1-2H3/b28-23+/t21-,24+,25+,27+/m0/s1 |
| InChIKey | WLLZGLIEFLKXTE-HLCIGZJDSA-N |
| XLogP | 3.74 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|