C29H27ClF6N2OS — CID 139122278
benzyl-[[4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]methyl]azanium chloride (PubChem CID 139122278) has the molecular formula C29H27ClF6N2OS and a molecular weight of 601.06 g/mol. Its IUPAC name is benzyl-[[4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]methyl]azanium chloride.
| Compound Name | benzyl-[[4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]methyl]azanium chloride |
|---|---|
| PubChem CID | 139122278 |
| Molecular Formula | C29H27ClF6N2OS |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | benzyl-[[4-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]methyl]azanium chloride |
| SMILES | COc1ccc2c(c1)c(C1=C(c3cc(C[NH2+]Cc4ccccc4)sc3C)C(F)(F)C(F)(F)C1(F)F)c(C)n2C.[Cl-] |
| InChI | InChI=1S/C29H26F6N2OS.ClH/c1-16-24(22-12-19(38-4)10-11-23(22)37(16)3)26-25(27(30,31)29(34,35)28(26,32)33)21-13-20(39-17(21)2)15-36-14-18-8-6-5-7-9-18;/h5-13,36H,14-15H2,1-4H3;1H |
| InChIKey | IGDFPXMYNBXRCW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|