C42H30CuN4S8 — CID 139122300
copper 5,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-10,20-diphenylporphyrin-10,20-diylium-21,22,23,24-tetraide (PubChem CID 139122300) has the molecular formula C42H30CuN4S8 and a molecular weight of 910.81 g/mol. Its IUPAC name is copper 5,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-10,20-diphenylporphyrin-10,20-diylium-21,22,23,24-tetraide.
| Compound Name | copper 5,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-10,20-diphenylporphyrin-10,20-diylium-21,22,23,24-tetraide |
|---|---|
| PubChem CID | 139122300 |
| Molecular Formula | C42H30CuN4S8 |
| Molecular Weight | 910.81 g/mol |
| Exact Mass | 908.95 |
| IUPAC Name | copper 5,15-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-10,20-diphenylporphyrin-10,20-diylium-21,22,23,24-tetraide |
| SMILES | CSC1=C(SC)SC(=c2c3ccc([n-]3)[c+](-c3ccccc3)c3ccc([n-]3)c(=C3SC(SC)=C(SC)S3)c3ccc([n-]3)[c+](-c3ccccc3)c3ccc2[n-]3)S1.[Cu+2] |
| InChI | InChI=1S/C42H30N4S8.Cu/c1-47-39-40(48-2)52-37(51-39)35-29-19-15-25(43-29)33(23-11-7-5-8-12-23)27-17-21-31(45-27)36(38-53-41(49-3)42(50-4)54-38)32-22-18-28(46-32)34(24-13-9-6-10-14-24)26-16-20-30(35)44-26;/h5-22H,1-4H3;/q-2;+2 |
| InChIKey | YPJFJUWYEPKSMI-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.81 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|