C30H26B2Cl4 — CID 139122396
2,3,7,8-tetrachloro-5,10-bis(2,4,6-trimethylphenyl)boranthrene (PubChem CID 139122396) has the molecular formula C30H26B2Cl4 and a molecular weight of 549.97 g/mol. Its IUPAC name is 2,3,7,8-tetrachloro-5,10-bis(2,4,6-trimethylphenyl)boranthrene.
| Compound Name | 2,3,7,8-tetrachloro-5,10-bis(2,4,6-trimethylphenyl)boranthrene |
|---|---|
| PubChem CID | 139122396 |
| Molecular Formula | C30H26B2Cl4 |
| Molecular Weight | 549.97 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 2,3,7,8-tetrachloro-5,10-bis(2,4,6-trimethylphenyl)boranthrene |
| SMILES | Cc1cc(C)c(B2c3cc(Cl)c(Cl)cc3B(c3c(C)cc(C)cc3C)c3cc(Cl)c(Cl)cc32)c(C)c1 |
| InChI | InChI=1S/C30H26B2Cl4/c1-15-7-17(3)29(18(4)8-15)31-21-11-25(33)27(35)13-23(21)32(24-14-28(36)26(34)12-22(24)31)30-19(5)9-16(2)10-20(30)6/h7-14H,1-6H3 |
| InChIKey | VFQAYVRXDNLROR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.97 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|