C42H36F10N6 — CID 139122545
bis(acetonitrile);5,5,10,15,15,20-hexamethyl-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 139122545) has the molecular formula C42H36F10N6 and a molecular weight of 814.77 g/mol. Its IUPAC name is bis(acetonitrile);5,5,10,15,15,20-hexamethyl-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | bis(acetonitrile);5,5,10,15,15,20-hexamethyl-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 139122545 |
| Molecular Formula | C42H36F10N6 |
| Molecular Weight | 814.77 g/mol |
| Exact Mass | 814.28 |
| IUPAC Name | bis(acetonitrile);5,5,10,15,15,20-hexamethyl-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC#N.CC#N.CC1(C)c2ccc([nH]2)C(C)(c2c(F)c(F)c(F)c(F)c2F)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(c2c(F)c(F)c(F)c(F)c2F)c2ccc1[nH]2 |
| InChI | InChI=1S/C38H30F10N4.2C2H3N/c1-35(2)15-7-11-19(49-15)37(5,23-25(39)29(43)33(47)30(44)26(23)40)21-13-9-17(51-21)36(3,4)18-10-14-22(52-18)38(6,20-12-8-16(35)50-20)24-27(41)31(45)34(48)32(46)28(24)42;2*1-2-3/h7-14,49-52H,1-6H3;2*1H3 |
| InChIKey | UVPLDEKIPUXGDK-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.77 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|