C13H20O2 — CID 139122861
(1R,2S,5R,6S,8R)-1,4,6,8-tetramethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol (PubChem CID 139122861) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,2S,5R,6S,8R)-1,4,6,8-tetramethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol.
| Compound Name | (1R,2S,5R,6S,8R)-1,4,6,8-tetramethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol |
|---|---|
| PubChem CID | 139122861 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,2S,5R,6S,8R)-1,4,6,8-tetramethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol |
| SMILES | CC1=C[C@H]2[C@]3(C)CO[C@@]2(C)[C@@](C)(C3)[C@@H]1O |
| InChI | InChI=1S/C13H20O2/c1-8-5-9-11(2)6-12(3,10(8)14)13(9,4)15-7-11/h5,9-10,14H,6-7H2,1-4H3/t9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | GQHPDIIJTLOROO-FPYNETTCSA-N |
| XLogP | 2.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|