C34H24N2O4 — CID 139123354
4-pyridin-4-ylpyridine;tetraphenylene-1,8,9,16-tetrol (PubChem CID 139123354) has the molecular formula C34H24N2O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is 4-pyridin-4-ylpyridine;tetraphenylene-1,8,9,16-tetrol.
| Compound Name | 4-pyridin-4-ylpyridine;tetraphenylene-1,8,9,16-tetrol |
|---|---|
| PubChem CID | 139123354 |
| Molecular Formula | C34H24N2O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 4-pyridin-4-ylpyridine;tetraphenylene-1,8,9,16-tetrol |
| SMILES | Oc1cccc2c1-c1c(O)cccc1-c1cccc(O)c1-c1c(O)cccc1-2.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C24H16O4.C10H8N2/c25-17-9-1-5-13-14-6-2-10-18(26)22(14)24-16(8-4-12-20(24)28)15-7-3-11-19(27)23(15)21(13)17;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-12,25-28H;1-8H/b14-13-,16-15-,23-21-,24-22-; |
| InChIKey | ZPNQMFXVAXTDBW-ZYELHEIQSA-N |
| XLogP | 7.63 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |