About N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine
N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine (PubChem CID 139124078) has the molecular formula C38H42N2
and a molecular weight of 526.77 g/mol. Its IUPAC name is N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine |
| PubChem CID | 139124078 |
| Molecular Formula | C38H42N2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine |
| SMILES | CC/C=C(/CC)N=C(c1ccccc1)c1ccccc1.CC/C=C(/CC)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C19H21N/c2*1-3-11-18(4-2)20-19(16-12-7-5-8-13-16)17-14-9-6-10-15-17/h2*5-15H,3-4H2,1-2H3/b2*18-11- |
| InChIKey | DYCAKSHTIIRIGN-ZEPWNIQXSA-N |
| XLogP | 10.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine?
The IUPAC name of N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine (CID 139124078) is N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine.
What is the SMILES notation for N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine?
The canonical SMILES for N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine is CC/C=C(/CC)N=C(c1ccccc1)c1ccccc1.CC/C=C(/CC)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine?
The InChIKey is DYCAKSHTIIRIGN-ZEPWNIQXSA-N. The full InChI is InChI=1S/2C19H21N/c2*1-3-11-18(4-2)20-19(16-12-7-5-8-13-16)17-14-9-6-10-15-17/h2*5-15H,3-4H2,1-2H3/b2*18-11-.
What are the key properties of N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine?
N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine has a molecular weight of 526.77 g/mol, XLogP of 10.46, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-hex-3-en-3-yl]-1,1-diphenylmethanimine is sourced from PubChem (CID 139124078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).