C28H36 — CID 139124123
(1R,3Z,6R,7S,12S)-3-[(1S,6S,7R,12R)-3-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylidene]pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 139124123) has the molecular formula C28H36 and a molecular weight of 372.60 g/mol. Its IUPAC name is (1R,3Z,6R,7S,12S)-3-[(1S,6S,7R,12R)-3-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylidene]pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | (1R,3Z,6R,7S,12S)-3-[(1S,6S,7R,12R)-3-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylidene]pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 139124123 |
| Molecular Formula | C28H36 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | (1R,3Z,6R,7S,12S)-3-[(1S,6S,7R,12R)-3-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylidene]pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | C1C2C[C@@H]3C4/C(=C5/C6C[C@@H]7C8CC9C[C@@H]7C5[C@H](C9)[C@H]8C6)C5C[C@@H]3C1[C@H](C5)[C@H]4C2 |
| InChI | InChI=1S/C28H36/c1-11-3-21-17-7-13-8-18(15(1)17)22(4-11)27(21)25(13)26-14-9-19-16-2-12-5-23(19)28(26)24(6-12)20(16)10-14/h11-24,27-28H,1-10H2/b26-25-/t11?,12?,13?,14?,15?,16?,17-,18+,19-,20+,21+,22-,23+,24-,27?,28? |
| InChIKey | AZIUIFINPJROOB-FQHZIPLYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|