C22H18FN — CID 139124130
N-[(Z)-1,2-diphenylethenyl]-1-(4-fluorophenyl)ethanimine (PubChem CID 139124130) has the molecular formula C22H18FN and a molecular weight of 315.39 g/mol. Its IUPAC name is N-[(Z)-1,2-diphenylethenyl]-1-(4-fluorophenyl)ethanimine.
| Compound Name | N-[(Z)-1,2-diphenylethenyl]-1-(4-fluorophenyl)ethanimine |
|---|---|
| PubChem CID | 139124130 |
| Molecular Formula | C22H18FN |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[(Z)-1,2-diphenylethenyl]-1-(4-fluorophenyl)ethanimine |
| SMILES | C/C(=N\C(=C/c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FN/c1-17(19-12-14-21(23)15-13-19)24-22(20-10-6-3-7-11-20)16-18-8-4-2-5-9-18/h2-16H,1H3/b22-16-,24-17+ |
| InChIKey | RHAFDKOHFWYVJC-HVYPPAAASA-N |
| XLogP | 5.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|