About (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one
(3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one (PubChem CID 139124988) has the molecular formula C20H18F4N2O4
and a molecular weight of 426.37 g/mol. Its IUPAC name is (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one |
| PubChem CID | 139124988 |
| Molecular Formula | C20H18F4N2O4 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one |
| SMILES | CO[C@H]1NC(=O)c2ccccc2C1(F)F.CO[C@H]1NC(=O)c2ccccc2C1(F)F |
| InChI | InChI=1S/2C10H9F2NO2/c2*1-15-9-10(11,12)7-5-3-2-4-6(7)8(14)13-9/h2*2-5,9H,1H3,(H,13,14)/t2*9-/m11/s1 |
| InChIKey | QXJHOFQGQPTSBD-USJXWOKUSA-N |
| XLogP | 2.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one?
The IUPAC name of (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one (CID 139124988) is (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one.
What is the SMILES notation for (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one?
The canonical SMILES for (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one is CO[C@H]1NC(=O)c2ccccc2C1(F)F.CO[C@H]1NC(=O)c2ccccc2C1(F)F.
What is the InChIKey of (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one?
The InChIKey is QXJHOFQGQPTSBD-USJXWOKUSA-N. The full InChI is InChI=1S/2C10H9F2NO2/c2*1-15-9-10(11,12)7-5-3-2-4-6(7)8(14)13-9/h2*2-5,9H,1H3,(H,13,14)/t2*9-/m11/s1.
What are the key properties of (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one?
(3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one has a molecular weight of 426.37 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,4-difluoro-3-methoxy-2,3-dihydroisoquinolin-1-one is sourced from PubChem (CID 139124988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).