C14H11BBr2N2O2 — CID 139125201
(2,6-dibromophenyl)boronic acid;1,8-naphthyridine (PubChem CID 139125201) has the molecular formula C14H11BBr2N2O2 and a molecular weight of 409.87 g/mol. Its IUPAC name is (2,6-dibromophenyl)boronic acid;1,8-naphthyridine.
| Compound Name | (2,6-dibromophenyl)boronic acid;1,8-naphthyridine |
|---|---|
| PubChem CID | 139125201 |
| Molecular Formula | C14H11BBr2N2O2 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | (2,6-dibromophenyl)boronic acid;1,8-naphthyridine |
| SMILES | OB(O)c1c(Br)cccc1Br.c1cnc2ncccc2c1 |
| InChI | InChI=1S/C8H6N2.C6H5BBr2O2/c1-3-7-4-2-6-10-8(7)9-5-1;8-4-2-1-3-5(9)6(4)7(10)11/h1-6H;1-3,10-11H |
| InChIKey | NJKCGNBESAWVHK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|