About (4-chlorophenyl)boronic acid;1,8-naphthyridine
(4-chlorophenyl)boronic acid;1,8-naphthyridine (PubChem CID 139125206) has the molecular formula C14H12BClN2O2
and a molecular weight of 286.53 g/mol. Its IUPAC name is (4-chlorophenyl)boronic acid;1,8-naphthyridine.
Molecular Properties
| Compound Name | (4-chlorophenyl)boronic acid;1,8-naphthyridine |
| PubChem CID | 139125206 |
| Molecular Formula | C14H12BClN2O2 |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (4-chlorophenyl)boronic acid;1,8-naphthyridine |
| SMILES | OB(O)c1ccc(Cl)cc1.c1cnc2ncccc2c1 |
| InChI | InChI=1S/C8H6N2.C6H6BClO2/c1-3-7-4-2-6-10-8(7)9-5-1;8-6-3-1-5(2-4-6)7(9)10/h1-6H;1-4,9-10H |
| InChIKey | SGZPPQZHMZFRQP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)boronic acid;1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)boronic acid;1,8-naphthyridine?
The IUPAC name of (4-chlorophenyl)boronic acid;1,8-naphthyridine (CID 139125206) is (4-chlorophenyl)boronic acid;1,8-naphthyridine.
What is the SMILES notation for (4-chlorophenyl)boronic acid;1,8-naphthyridine?
The canonical SMILES for (4-chlorophenyl)boronic acid;1,8-naphthyridine is OB(O)c1ccc(Cl)cc1.c1cnc2ncccc2c1.
What is the InChIKey of (4-chlorophenyl)boronic acid;1,8-naphthyridine?
The InChIKey is SGZPPQZHMZFRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C6H6BClO2/c1-3-7-4-2-6-10-8(7)9-5-1;8-6-3-1-5(2-4-6)7(9)10/h1-6H;1-4,9-10H.
What are the key properties of (4-chlorophenyl)boronic acid;1,8-naphthyridine?
(4-chlorophenyl)boronic acid;1,8-naphthyridine has a molecular weight of 286.53 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)boronic acid;1,8-naphthyridine is sourced from PubChem (CID 139125206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).