C17H25NO3 — CID 139125232
(1R,2S,9R,12S,14R)-2-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione (PubChem CID 139125232) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (1R,2S,9R,12S,14R)-2-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione.
| Compound Name | (1R,2S,9R,12S,14R)-2-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione |
|---|---|
| PubChem CID | 139125232 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (1R,2S,9R,12S,14R)-2-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione |
| SMILES | CN1CCC[C@@]23C(=O)C[C@H]4C[C@@H]2CC(=O)[C@@]3(C4)[C@@H](O)CC1 |
| InChI | InChI=1S/C17H25NO3/c1-18-5-2-4-16-12-7-11(8-14(16)20)10-17(16,15(21)9-12)13(19)3-6-18/h11-13,19H,2-10H2,1H3/t11-,12-,13+,16+,17-/m1/s1 |
| InChIKey | PHXIDWHIVDWGMJ-ZWNONLRRSA-N |
| XLogP | 1.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |