C31H50O7Si2 — CID 139125389
(3S,3aR,4R,6S,6aS,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a,6-dihydroxy-3,6,9-trimethyl-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one (PubChem CID 139125389) has the molecular formula C31H50O7Si2 and a molecular weight of 590.91 g/mol. Its IUPAC name is (3S,3aR,4R,6S,6aS,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a,6-dihydroxy-3,6,9-trimethyl-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3S,3aR,4R,6S,6aS,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a,6-dihydroxy-3,6,9-trimethyl-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 139125389 |
| Molecular Formula | C31H50O7Si2 |
| Molecular Weight | 590.91 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | (3S,3aR,4R,6S,6aS,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a,6-dihydroxy-3,6,9-trimethyl-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one |
| SMILES | CC1=C2[C@@H]3OC(=O)[C@@](C)(O[Si](C)(C)C)[C@@]3(O)[C@H](OCc3ccccc3)C[C@](C)(O)[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H50O7Si2/c1-20-23(37-40(10,11)28(2,3)4)17-22-25(20)26-31(34,30(6,27(32)36-26)38-39(7,8)9)24(18-29(22,5)33)35-19-21-15-13-12-14-16-21/h12-16,22-24,26,33-34H,17-19H2,1-11H3/t22-,23+,24+,26-,29-,30+,31+/m0/s1 |
| InChIKey | YSDAFYLMDLMFGM-TXGBSJGLSA-N |
| XLogP | 5.72 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.91 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|