C11H15NO — CID 139125618
7,9-dimethyl-1-azaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 139125618) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 7,9-dimethyl-1-azaspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | 7,9-dimethyl-1-azaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 139125618 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 7,9-dimethyl-1-azaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | CC1=CC2(C=C(C)C1=O)CCCN2 |
| InChI | InChI=1S/C11H15NO/c1-8-6-11(4-3-5-12-11)7-9(2)10(8)13/h6-7,12H,3-5H2,1-2H3 |
| InChIKey | SRHZETITVQTEOA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |