About 1-methylphosphindole-2,3-dithiol
1-methylphosphindole-2,3-dithiol (PubChem CID 139125832) has the molecular formula C9H9PS2
and a molecular weight of 212.28 g/mol. Its IUPAC name is 1-methylphosphindole-2,3-dithiol.
Molecular Properties
| Compound Name | 1-methylphosphindole-2,3-dithiol |
| PubChem CID | 139125832 |
| Molecular Formula | C9H9PS2 |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 1-methylphosphindole-2,3-dithiol |
| SMILES | Cp1c(S)c(S)c2ccccc21 |
| InChI | InChI=1S/C9H9PS2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5,11-12H,1H3 |
| InChIKey | NEUYWAHSXHLRIH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylphosphindole-2,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylphosphindole-2,3-dithiol?
The IUPAC name of 1-methylphosphindole-2,3-dithiol (CID 139125832) is 1-methylphosphindole-2,3-dithiol.
What is the SMILES notation for 1-methylphosphindole-2,3-dithiol?
The canonical SMILES for 1-methylphosphindole-2,3-dithiol is Cp1c(S)c(S)c2ccccc21.
What is the InChIKey of 1-methylphosphindole-2,3-dithiol?
The InChIKey is NEUYWAHSXHLRIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9PS2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5,11-12H,1H3.
What are the key properties of 1-methylphosphindole-2,3-dithiol?
1-methylphosphindole-2,3-dithiol has a molecular weight of 212.28 g/mol, XLogP of 3.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylphosphindole-2,3-dithiol is sourced from PubChem (CID 139125832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).