About 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine
1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine (PubChem CID 139127713) has the molecular formula C4H8BrN4+
and a molecular weight of 192.04 g/mol. Its IUPAC name is 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine.
Molecular Properties
| Compound Name | 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine |
| PubChem CID | 139127713 |
| Molecular Formula | C4H8BrN4+ |
| Molecular Weight | 192.04 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine |
| SMILES | N[n+]1cnn(CCBr)c1 |
| InChI | InChI=1S/C4H8BrN4/c5-1-2-9-4-8(6)3-7-9/h3-4H,1-2,6H2/q+1 |
| InChIKey | USSYFGPHCFOSRD-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.04 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine?
The IUPAC name of 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine (CID 139127713) is 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine.
What is the SMILES notation for 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine?
The canonical SMILES for 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine is N[n+]1cnn(CCBr)c1.
What is the InChIKey of 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine?
The InChIKey is USSYFGPHCFOSRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BrN4/c5-1-2-9-4-8(6)3-7-9/h3-4H,1-2,6H2/q+1.
What are the key properties of 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine?
1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine has a molecular weight of 192.04 g/mol, XLogP of -0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromoethyl)-1,2,4-triazol-4-ium-4-amine is sourced from PubChem (CID 139127713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).