C16H6F12FeN3O4S2 — CID 139128269
bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);iron(3+);4-pyridin-2-yl-1,2-dithia-5-aza-3-azanidacyclopent-4-ene (PubChem CID 139128269) has the molecular formula C16H6F12FeN3O4S2 and a molecular weight of 652.20 g/mol. Its IUPAC name is bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);iron(3+);4-pyridin-2-yl-1,2-dithia-5-aza-3-azanidacyclopent-4-ene.
| Compound Name | bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);iron(3+);4-pyridin-2-yl-1,2-dithia-5-aza-3-azanidacyclopent-4-ene |
|---|---|
| PubChem CID | 139128269 |
| Molecular Formula | C16H6F12FeN3O4S2 |
| Molecular Weight | 652.20 g/mol |
| Exact Mass | 651.90 |
| IUPAC Name | bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);iron(3+);4-pyridin-2-yl-1,2-dithia-5-aza-3-azanidacyclopent-4-ene |
| SMILES | O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.[Fe+3].c1ccc(C2=NSS[N-]2)nc1 |
| InChI | InChI=1S/C6H4N3S2.2C5H2F6O2.Fe/c1-2-4-7-5(3-1)6-8-10-11-9-6;2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-4H;2*1,12H;/q-1;;;+3/p-2/b;2*2-1-; |
| InChIKey | PNUNRYKHGAAILU-VIBDZMCESA-L |
| XLogP | 4.27 |
| TPSA | 119.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|