About copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite
copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite (PubChem CID 139128441) has the molecular formula C16H23CuN3O3
and a molecular weight of 368.92 g/mol. Its IUPAC name is copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite.
Molecular Properties
| Compound Name | copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite |
| PubChem CID | 139128441 |
| Molecular Formula | C16H23CuN3O3 |
| Molecular Weight | 368.92 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite |
| SMILES | CCN(CC)CC/N=C(C)/C=C(\[O-])c1ccccc1.O=N[O-].[Cu+2] |
| InChI | InChI=1S/C16H24N2O.Cu.HNO2/c1-4-18(5-2)12-11-17-14(3)13-16(19)15-9-7-6-8-10-15;;2-1-3/h6-10,13,19H,4-5,11-12H2,1-3H3;;(H,2,3)/q;+2;/p-2/b16-13-,17-14+;; |
| InChIKey | LVDMQBDWHATHDX-JIWUARJNSA-L |
| XLogP | 2.44 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.92 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite?
The IUPAC name of copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite (CID 139128441) is copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite.
What is the SMILES notation for copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite?
The canonical SMILES for copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite is CCN(CC)CC/N=C(C)/C=C(\[O-])c1ccccc1.O=N[O-].[Cu+2].
What is the InChIKey of copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite?
The InChIKey is LVDMQBDWHATHDX-JIWUARJNSA-L. The full InChI is InChI=1S/C16H24N2O.Cu.HNO2/c1-4-18(5-2)12-11-17-14(3)13-16(19)15-9-7-6-8-10-15;;2-1-3/h6-10,13,19H,4-5,11-12H2,1-3H3;;(H,2,3)/q;+2;/p-2/b16-13-,17-14+;;.
What are the key properties of copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite?
copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite has a molecular weight of 368.92 g/mol, XLogP of 2.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(Z)-3-[2-(diethylamino)ethylimino]-1-phenylbut-1-en-1-olate;nitrite is sourced from PubChem (CID 139128441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).