About acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate
acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate (PubChem CID 139128519) has the molecular formula C30H24CuN7O3S
and a molecular weight of 626.18 g/mol. Its IUPAC name is acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate.
Molecular Properties
| Compound Name | acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate |
| PubChem CID | 139128519 |
| Molecular Formula | C30H24CuN7O3S |
| Molecular Weight | 626.18 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate |
| SMILES | CC#N.O=S(=O)([O-])C(n1ccc(-c2ccccc2)n1)(n1ccc(-c2ccccc2)n1)n1ccc(-c2ccccc2)n1.[Cu+] |
| InChI | InChI=1S/C28H22N6O3S.C2H3N.Cu/c35-38(36,37)28(32-19-16-25(29-32)22-10-4-1-5-11-22,33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;1-2-3;/h1-21H,(H,35,36,37);1H3;/q;;+1/p-1 |
| InChIKey | SUXOLLOIXGILKF-UHFFFAOYSA-M |
| XLogP | 5.01 |
| TPSA | 134.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate?
The IUPAC name of acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate (CID 139128519) is acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate.
What is the SMILES notation for acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate?
The canonical SMILES for acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate is CC#N.O=S(=O)([O-])C(n1ccc(-c2ccccc2)n1)(n1ccc(-c2ccccc2)n1)n1ccc(-c2ccccc2)n1.[Cu+].
What is the InChIKey of acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate?
The InChIKey is SUXOLLOIXGILKF-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H22N6O3S.C2H3N.Cu/c35-38(36,37)28(32-19-16-25(29-32)22-10-4-1-5-11-22,33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;1-2-3;/h1-21H,(H,35,36,37);1H3;/q;;+1/p-1.
What are the key properties of acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate?
acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate has a molecular weight of 626.18 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;copper(1+);tris(3-phenylpyrazol-1-yl)methanesulfonate is sourced from PubChem (CID 139128519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).