About cyanoiminomethylideneazanide;tetradeuterioazanium
cyanoiminomethylideneazanide;tetradeuterioazanium (PubChem CID 139130085) has the molecular formula C2H4N4
and a molecular weight of 88.11 g/mol. Its IUPAC name is cyanoiminomethylideneazanide;tetradeuterioazanium.
Molecular Properties
| Compound Name | cyanoiminomethylideneazanide;tetradeuterioazanium |
| PubChem CID | 139130085 |
| Molecular Formula | C2H4N4 |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.07 |
| IUPAC Name | cyanoiminomethylideneazanide;tetradeuterioazanium |
| SMILES | N#CN=C=[N-].[2H][N+]([2H])([2H])[2H] |
| InChI | InChI=1S/C2N3.H3N/c3-1-5-2-4;/h;1H3/q-1;/p+1/i/hD4 |
| InChIKey | GUDDEHBNGLZMKA-JBISRTOLSA-O |
| XLogP | 0.59 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyanoiminomethylideneazanide;tetradeuterioazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanoiminomethylideneazanide;tetradeuterioazanium?
The IUPAC name of cyanoiminomethylideneazanide;tetradeuterioazanium (CID 139130085) is cyanoiminomethylideneazanide;tetradeuterioazanium.
What is the SMILES notation for cyanoiminomethylideneazanide;tetradeuterioazanium?
The canonical SMILES for cyanoiminomethylideneazanide;tetradeuterioazanium is N#CN=C=[N-].[2H][N+]([2H])([2H])[2H].
What is the InChIKey of cyanoiminomethylideneazanide;tetradeuterioazanium?
The InChIKey is GUDDEHBNGLZMKA-JBISRTOLSA-O. The full InChI is InChI=1S/C2N3.H3N/c3-1-5-2-4;/h;1H3/q-1;/p+1/i/hD4.
What are the key properties of cyanoiminomethylideneazanide;tetradeuterioazanium?
cyanoiminomethylideneazanide;tetradeuterioazanium has a molecular weight of 88.11 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyanoiminomethylideneazanide;tetradeuterioazanium is sourced from PubChem (CID 139130085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).