About zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide
zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide (PubChem CID 139130455) has the molecular formula C32H31BN6O3Zn
and a molecular weight of 623.84 g/mol. Its IUPAC name is zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide.
Molecular Properties
| Compound Name | zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide |
| PubChem CID | 139130455 |
| Molecular Formula | C32H31BN6O3Zn |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide |
| SMILES | COC(=O)[O-].Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.[Zn+2] |
| InChI | InChI=1S/C30H28BN6.C2H4O3.Zn/c1-22-19-28(25-13-7-4-8-14-25)32-35(22)31(36-23(2)20-29(33-36)26-15-9-5-10-16-26)37-24(3)21-30(34-37)27-17-11-6-12-18-27;1-5-2(3)4;/h4-21,31H,1-3H3;1H3,(H,3,4);/q-1;;+2/p-1 |
| InChIKey | PWXBKIUYEBHIDD-UHFFFAOYSA-M |
| XLogP | 4.84 |
| TPSA | 102.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide?
The IUPAC name of zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide (CID 139130455) is zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide.
What is the SMILES notation for zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide?
The canonical SMILES for zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide is COC(=O)[O-].Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.[Zn+2].
What is the InChIKey of zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide?
The InChIKey is PWXBKIUYEBHIDD-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H28BN6.C2H4O3.Zn/c1-22-19-28(25-13-7-4-8-14-25)32-35(22)31(36-23(2)20-29(33-36)26-15-9-5-10-16-26)37-24(3)21-30(34-37)27-17-11-6-12-18-27;1-5-2(3)4;/h4-21,31H,1-3H3;1H3,(H,3,4);/q-1;;+2/p-1.
What are the key properties of zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide?
zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide has a molecular weight of 623.84 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;methyl carbonate;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide is sourced from PubChem (CID 139130455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).