About bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+)
bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) (PubChem CID 139130645) has the molecular formula C36H30MoN8S2
and a molecular weight of 734.77 g/mol. Its IUPAC name is bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+).
Molecular Properties
| Compound Name | bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) |
| PubChem CID | 139130645 |
| Molecular Formula | C36H30MoN8S2 |
| Molecular Weight | 734.77 g/mol |
| Exact Mass | 736.11 |
| IUPAC Name | bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) |
| SMILES | CSc1ccccc1[N-]c1ccccc1/N=N/c1ccccn1.CSc1ccccc1[N-]c1ccccc1/N=N/c1ccccn1.[Mo+2] |
| InChI | InChI=1S/2C18H15N4S.Mo/c2*1-23-17-11-5-4-10-16(17)20-14-8-2-3-9-15(14)21-22-18-12-6-7-13-19-18;/h2*2-13H,1H3;/q2*-1;+2/b2*22-21+; |
| InChIKey | YCLPZBTYKBGCJA-JTVZJQPRSA-N |
| XLogP | 13.11 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 734.77 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+)?
The IUPAC name of bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) (CID 139130645) is bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+).
What is the SMILES notation for bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+)?
The canonical SMILES for bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) is CSc1ccccc1[N-]c1ccccc1/N=N/c1ccccn1.CSc1ccccc1[N-]c1ccccc1/N=N/c1ccccn1.[Mo+2].
What is the InChIKey of bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+)?
The InChIKey is YCLPZBTYKBGCJA-JTVZJQPRSA-N. The full InChI is InChI=1S/2C18H15N4S.Mo/c2*1-23-17-11-5-4-10-16(17)20-14-8-2-3-9-15(14)21-22-18-12-6-7-13-19-18;/h2*2-13H,1H3;/q2*-1;+2/b2*22-21+;.
What are the key properties of bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+)?
bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) has a molecular weight of 734.77 g/mol, XLogP of 13.11, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2-methylsulfanylphenyl)-[2-(pyridin-2-yldiazenyl)phenyl]azanide);molybdenum(2+) is sourced from PubChem (CID 139130645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).