C41H30DyF9N2O6S3 — CID 139131632
(1S,9S)-10,10-dimethyl-5-pyridin-2-yl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;dysprosium(3+);tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) (PubChem CID 139131632) has the molecular formula C41H30DyF9N2O6S3 and a molecular weight of 1076.38 g/mol. Its IUPAC name is (1S,9S)-10,10-dimethyl-5-pyridin-2-yl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;dysprosium(3+);tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate).
| Compound Name | (1S,9S)-10,10-dimethyl-5-pyridin-2-yl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;dysprosium(3+);tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
|---|---|
| PubChem CID | 139131632 |
| Molecular Formula | C41H30DyF9N2O6S3 |
| Molecular Weight | 1076.38 g/mol |
| Exact Mass | 1077.04 |
| IUPAC Name | (1S,9S)-10,10-dimethyl-5-pyridin-2-yl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;dysprosium(3+);tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
| SMILES | CC1(C)[C@@H]2Cc3cc(-c4ccccn4)ncc3[C@H]1C2.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.[Dy+3] |
| InChI | InChI=1S/C17H18N2.3C8H5F3O2S.Dy/c1-17(2)12-7-11-8-16(15-5-3-4-6-18-15)19-10-13(11)14(17)9-12;3*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h3-6,8,10,12,14H,7,9H2,1-2H3;3*1-4,13H;/q;;;;+3/p-3/b;3*7-4-;/t12-,14-;;;;/m1..../s1 |
| InChIKey | XBVAJILRBABNQS-CAPQDSKWSA-K |
| XLogP | 9.04 |
| TPSA | 146.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1076.38 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|