C49H76GeNOP — CID 139132649
[(3R,5R)-2,5-ditert-butyl-3-phenyl-5-[2,4,6-tri(propan-2-yl)phenyl]-1,2,5-oxazagermolidin-4-ylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 139132649) has the molecular formula C49H76GeNOP and a molecular weight of 798.74 g/mol. Its IUPAC name is [(3R,5R)-2,5-ditert-butyl-3-phenyl-5-[2,4,6-tri(propan-2-yl)phenyl]-1,2,5-oxazagermolidin-4-ylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [(3R,5R)-2,5-ditert-butyl-3-phenyl-5-[2,4,6-tri(propan-2-yl)phenyl]-1,2,5-oxazagermolidin-4-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 139132649 |
| Molecular Formula | C49H76GeNOP |
| Molecular Weight | 798.74 g/mol |
| Exact Mass | 799.49 |
| IUPAC Name | [(3R,5R)-2,5-ditert-butyl-3-phenyl-5-[2,4,6-tri(propan-2-yl)phenyl]-1,2,5-oxazagermolidin-4-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)c1cc(C(C)C)c([Ge@@]2(C(C)(C)C)ON(C(C)(C)C)[C@H](c3ccccc3)/C2=P\c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C49H76GeNOP/c1-31(2)35-27-37(32(3)4)41(38(28-35)33(5)6)50(48(16,17)18)44(42(34-25-23-22-24-26-34)51(52-50)49(19,20)21)53-43-39(46(10,11)12)29-36(45(7,8)9)30-40(43)47(13,14)15/h22-33,42H,1-21H3/t42-,50-/m1/s1 |
| InChIKey | JSKYZEQURVOZHT-MKVVGXHPSA-N |
| XLogP | 13.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.74 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|