About 2-pyridin-2-yl-1,3-benzothiazole
2-pyridin-2-yl-1,3-benzothiazole (PubChem CID 139132976) has the molecular formula C24H16N4S2
and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-pyridin-2-yl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-1,3-benzothiazole |
| PubChem CID | 139132976 |
| Molecular Formula | C24H16N4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-pyridin-2-yl-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc3ccccc3s2)nc1.c1ccc(-c2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/2C12H8N2S/c2*1-2-7-11-9(5-1)14-12(15-11)10-6-3-4-8-13-10/h2*1-8H |
| InChIKey | RVFIYBLQKWRONO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-pyridin-2-yl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-1,3-benzothiazole?
The IUPAC name of 2-pyridin-2-yl-1,3-benzothiazole (CID 139132976) is 2-pyridin-2-yl-1,3-benzothiazole.
What is the SMILES notation for 2-pyridin-2-yl-1,3-benzothiazole?
The canonical SMILES for 2-pyridin-2-yl-1,3-benzothiazole is c1ccc(-c2nc3ccccc3s2)nc1.c1ccc(-c2nc3ccccc3s2)nc1.
What is the InChIKey of 2-pyridin-2-yl-1,3-benzothiazole?
The InChIKey is RVFIYBLQKWRONO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8N2S/c2*1-2-7-11-9(5-1)14-12(15-11)10-6-3-4-8-13-10/h2*1-8H.
What are the key properties of 2-pyridin-2-yl-1,3-benzothiazole?
2-pyridin-2-yl-1,3-benzothiazole has a molecular weight of 424.55 g/mol, XLogP of 6.72, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-1,3-benzothiazole is sourced from PubChem (CID 139132976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).