About zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate
zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate (PubChem CID 139133615) has the molecular formula C29H37N3O3Zn
and a molecular weight of 541.02 g/mol. Its IUPAC name is zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate.
Molecular Properties
| Compound Name | zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate |
| PubChem CID | 139133615 |
| Molecular Formula | C29H37N3O3Zn |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate |
| SMILES | CC(=O)[O-].CC(C)(C)c1cc(CN(Cc2ccccn2)Cc2ccccn2)c([O-])c(C(C)(C)C)c1.[Zn+2] |
| InChI | InChI=1S/C27H35N3O.C2H4O2.Zn/c1-26(2,3)21-15-20(25(31)24(16-21)27(4,5)6)17-30(18-22-11-7-9-13-28-22)19-23-12-8-10-14-29-23;1-2(3)4;/h7-16,31H,17-19H2,1-6H3;1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | UUYQZADMRDQYKU-UHFFFAOYSA-L |
| XLogP | 4.10 |
| TPSA | 92.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate?
The IUPAC name of zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate (CID 139133615) is zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate.
What is the SMILES notation for zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate?
The canonical SMILES for zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate is CC(=O)[O-].CC(C)(C)c1cc(CN(Cc2ccccn2)Cc2ccccn2)c([O-])c(C(C)(C)C)c1.[Zn+2].
What is the InChIKey of zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate?
The InChIKey is UUYQZADMRDQYKU-UHFFFAOYSA-L. The full InChI is InChI=1S/C27H35N3O.C2H4O2.Zn/c1-26(2,3)21-15-20(25(31)24(16-21)27(4,5)6)17-30(18-22-11-7-9-13-28-22)19-23-12-8-10-14-29-23;1-2(3)4;/h7-16,31H,17-19H2,1-6H3;1H3,(H,3,4);/q;;+2/p-2.
What are the key properties of zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate?
zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate has a molecular weight of 541.02 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;acetate is sourced from PubChem (CID 139133615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).