About samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide)
samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) (PubChem CID 139133851) has the molecular formula C30H44B2N12Sm-2
and a molecular weight of 744.75 g/mol. Its IUPAC name is samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide).
Molecular Properties
| Compound Name | samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) |
| PubChem CID | 139133851 |
| Molecular Formula | C30H44B2N12Sm-2 |
| Molecular Weight | 744.75 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) |
| SMILES | Cc1cc(C)n([BH-](n2nc(C)cc2C)n2nc(C)cc2C)n1.Cc1cc(C)n([BH-](n2nc(C)cc2C)n2nc(C)cc2C)n1.[Sm] |
| InChI | InChI=1S/2C15H22BN6.Sm/c2*1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;/h2*7-9,16H,1-6H3;/q2*-1; |
| InChIKey | VDCPYPJLQLVWOM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 744.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide)?
The IUPAC name of samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) (CID 139133851) is samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide).
What is the SMILES notation for samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide)?
The canonical SMILES for samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) is Cc1cc(C)n([BH-](n2nc(C)cc2C)n2nc(C)cc2C)n1.Cc1cc(C)n([BH-](n2nc(C)cc2C)n2nc(C)cc2C)n1.[Sm].
What is the InChIKey of samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide)?
The InChIKey is VDCPYPJLQLVWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H22BN6.Sm/c2*1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;/h2*7-9,16H,1-6H3;/q2*-1;.
What are the key properties of samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide)?
samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) has a molecular weight of 744.75 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for samarium;bis(tris(3,5-dimethylpyrazol-1-yl)boranuide) is sourced from PubChem (CID 139133851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).