C39H54CuN2O — CID 139133972
copper;4-tert-butylphenolate;[2,6-di(propan-2-yl)phenyl]-[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]azanide (PubChem CID 139133972) has the molecular formula C39H54CuN2O and a molecular weight of 630.42 g/mol. Its IUPAC name is copper;4-tert-butylphenolate;[2,6-di(propan-2-yl)phenyl]-[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]azanide.
| Compound Name | copper;4-tert-butylphenolate;[2,6-di(propan-2-yl)phenyl]-[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]azanide |
|---|---|
| PubChem CID | 139133972 |
| Molecular Formula | C39H54CuN2O |
| Molecular Weight | 630.42 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | copper;4-tert-butylphenolate;[2,6-di(propan-2-yl)phenyl]-[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]azanide |
| SMILES | C/C(=C/C(C)=N/c1c(C(C)C)cccc1C(C)C)[N-]c1c(C(C)C)cccc1C(C)C.CC(C)(C)c1ccc([O-])cc1.[Cu+2] |
| InChI | InChI=1S/C29H41N2.C10H14O.Cu/c1-18(2)24-13-11-14-25(19(3)4)28(24)30-22(9)17-23(10)31-29-26(20(5)6)15-12-16-27(29)21(7)8;1-10(2,3)8-4-6-9(11)7-5-8;/h11-21H,1-10H3;4-7,11H,1-3H3;/q-1;;+2/p-1/b22-17-,31-23+;; |
| InChIKey | WAPZQONKNUGXFI-GGFZQTNZSA-M |
| XLogP | 11.94 |
| TPSA | 49.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.42 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|