About CID 139133998
CID 139133998 (PubChem CID 139133998) has the molecular formula C54H48B2CoN12
and a molecular weight of 945.62 g/mol.
Molecular Properties
| Compound Name | CID 139133998 |
| PubChem CID | 139133998 |
| Molecular Formula | C54H48B2CoN12 |
| Molecular Weight | 945.62 g/mol |
| Exact Mass | 945.36 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)n([B-](n2nc(C)cc2C)n2nc(C)cc2C)n1.[Co+2].c1ccc2c(-c3ccn([B-](n4ccc(-c5cccc6ccccc56)n4)n4ccc(-c5cccc6ccccc56)n4)n3)cccc2c1 |
| InChI | InChI=1S/C39H27BN6.C15H21BN6.Co/c1-4-16-31-28(10-1)13-7-19-34(31)37-22-25-44(41-37)40(45-26-23-38(42-45)35-20-8-14-29-11-2-5-17-32(29)35)46-27-24-39(43-46)36-21-9-15-30-12-3-6-18-33(30)36;1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;/h1-27H;7-9H,1-6H3;/q2*-1;+2 |
| InChIKey | BDKGPFFGSFMZRM-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 945.62 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139133998 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139133998?
The IUPAC name of CID 139133998 (CID 139133998) is not available.
What is the SMILES notation for CID 139133998?
The canonical SMILES for CID 139133998 is Cc1cc(C)n([B-](n2nc(C)cc2C)n2nc(C)cc2C)n1.[Co+2].c1ccc2c(-c3ccn([B-](n4ccc(-c5cccc6ccccc56)n4)n4ccc(-c5cccc6ccccc56)n4)n3)cccc2c1.
What is the InChIKey of CID 139133998?
The InChIKey is BDKGPFFGSFMZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H27BN6.C15H21BN6.Co/c1-4-16-31-28(10-1)13-7-19-34(31)37-22-25-44(41-37)40(45-26-23-38(42-45)35-20-8-14-29-11-2-5-17-32(29)35)46-27-24-39(43-46)36-21-9-15-30-12-3-6-18-33(30)36;1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;/h1-27H;7-9H,1-6H3;/q2*-1;+2.
What are the key properties of CID 139133998?
CID 139133998 has a molecular weight of 945.62 g/mol, XLogP of 10.72, 9 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139133998 is sourced from PubChem (CID 139133998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).