About copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine
copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine (PubChem CID 139134027) has the molecular formula C14H14CuN4O2
and a molecular weight of 333.84 g/mol. Its IUPAC name is copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine.
Molecular Properties
| Compound Name | copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine |
| PubChem CID | 139134027 |
| Molecular Formula | C14H14CuN4O2 |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine |
| SMILES | C/N=C(\[O-])c1cccc(/C([O-])=N/C)n1.[Cu+2].c1ccncc1 |
| InChI | InChI=1S/C9H11N3O2.C5H5N.Cu/c1-10-8(13)6-4-3-5-7(12-6)9(14)11-2;1-2-4-6-5-3-1;/h3-5H,1-2H3,(H,10,13)(H,11,14);1-5H;/q;;+2/p-2 |
| InChIKey | LVPFMQSHQCJOHH-UHFFFAOYSA-L |
| XLogP | -0.37 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine?
The IUPAC name of copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine (CID 139134027) is copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine.
What is the SMILES notation for copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine?
The canonical SMILES for copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine is C/N=C(\[O-])c1cccc(/C([O-])=N/C)n1.[Cu+2].c1ccncc1.
What is the InChIKey of copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine?
The InChIKey is LVPFMQSHQCJOHH-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H11N3O2.C5H5N.Cu/c1-10-8(13)6-4-3-5-7(12-6)9(14)11-2;1-2-4-6-5-3-1;/h3-5H,1-2H3,(H,10,13)(H,11,14);1-5H;/q;;+2/p-2.
What are the key properties of copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine?
copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine has a molecular weight of 333.84 g/mol, XLogP of -0.37, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-N,6-N-dimethylpyridine-2,6-dicarboximidate;pyridine is sourced from PubChem (CID 139134027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).