C47H41N11O4 — CID 139134176
acetonitrile;N-[2-[bis[2-(1,10-phenanthroline-2-carbonylamino)ethyl]amino]ethyl]-1,10-phenanthroline-2-carboxamide;hydrate (PubChem CID 139134176) has the molecular formula C47H41N11O4 and a molecular weight of 823.92 g/mol. Its IUPAC name is acetonitrile;N-[2-[bis[2-(1,10-phenanthroline-2-carbonylamino)ethyl]amino]ethyl]-1,10-phenanthroline-2-carboxamide;hydrate.
| Compound Name | acetonitrile;N-[2-[bis[2-(1,10-phenanthroline-2-carbonylamino)ethyl]amino]ethyl]-1,10-phenanthroline-2-carboxamide;hydrate |
|---|---|
| PubChem CID | 139134176 |
| Molecular Formula | C47H41N11O4 |
| Molecular Weight | 823.92 g/mol |
| Exact Mass | 823.33 |
| IUPAC Name | acetonitrile;N-[2-[bis[2-(1,10-phenanthroline-2-carbonylamino)ethyl]amino]ethyl]-1,10-phenanthroline-2-carboxamide;hydrate |
| SMILES | CC#N.O.O=C(NCCN(CCNC(=O)c1ccc2ccc3cccnc3c2n1)CCNC(=O)c1ccc2ccc3cccnc3c2n1)c1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C45H36N10O3.C2H3N.H2O/c56-43(34-16-13-31-10-7-28-4-1-19-46-37(28)40(31)52-34)49-22-25-55(26-23-50-44(57)35-17-14-32-11-8-29-5-2-20-47-38(29)41(32)53-35)27-24-51-45(58)36-18-15-33-12-9-30-6-3-21-48-39(30)42(33)54-36;1-2-3;/h1-21H,22-27H2,(H,49,56)(H,50,57)(H,51,58);1H3;1H2 |
| InChIKey | AIBQBIHIEAZSBP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 223.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|