About cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide
cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide (PubChem CID 139134991) has the molecular formula C32H29BCoN6O2
and a molecular weight of 599.37 g/mol. Its IUPAC name is cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide.
Molecular Properties
| Compound Name | cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide |
| PubChem CID | 139134991 |
| Molecular Formula | C32H29BCoN6O2 |
| Molecular Weight | 599.37 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide |
| SMILES | CC(=O)/C=C(/C)[O-].[Co+2].c1ccc(-c2ccn([BH-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/C27H22BN6.C5H8O2.Co/c1-4-10-22(11-5-1)25-16-19-32(29-25)28(33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;1-4(6)3-5(2)7;/h1-21,28H;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-; |
| InChIKey | BXJXUPFFXZZTOI-LWFKIUJUSA-M |
| XLogP | 4.78 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 599.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide?
The IUPAC name of cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide (CID 139134991) is cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide.
What is the SMILES notation for cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide?
The canonical SMILES for cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide is CC(=O)/C=C(/C)[O-].[Co+2].c1ccc(-c2ccn([BH-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1.
What is the InChIKey of cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide?
The InChIKey is BXJXUPFFXZZTOI-LWFKIUJUSA-M. The full InChI is InChI=1S/C27H22BN6.C5H8O2.Co/c1-4-10-22(11-5-1)25-16-19-32(29-25)28(33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;1-4(6)3-5(2)7;/h1-21,28H;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-;.
What are the key properties of cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide?
cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide has a molecular weight of 599.37 g/mol, XLogP of 4.78, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);(Z)-4-oxopent-2-en-2-olate;tris(3-phenylpyrazol-1-yl)boranuide is sourced from PubChem (CID 139134991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).