C53H66BCuN6O2 — CID 139135096
copper(1+);3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione;tris[5-methyl-3-(4-propan-2-ylphenyl)pyrazol-1-yl]boranuide (PubChem CID 139135096) has the molecular formula C53H66BCuN6O2 and a molecular weight of 893.51 g/mol. Its IUPAC name is copper(1+);3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione;tris[5-methyl-3-(4-propan-2-ylphenyl)pyrazol-1-yl]boranuide.
| Compound Name | copper(1+);3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione;tris[5-methyl-3-(4-propan-2-ylphenyl)pyrazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139135096 |
| Molecular Formula | C53H66BCuN6O2 |
| Molecular Weight | 893.51 g/mol |
| Exact Mass | 892.46 |
| IUPAC Name | copper(1+);3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione;tris[5-methyl-3-(4-propan-2-ylphenyl)pyrazol-1-yl]boranuide |
| SMILES | CC(C)(C)C1=CC(=O)C(=O)C(C(C)(C)C)=C1.Cc1cc(-c2ccc(C(C)C)cc2)nn1[BH-](n1nc(-c2ccc(C(C)C)cc2)cc1C)n1nc(-c2ccc(C(C)C)cc2)cc1C.[Cu+] |
| InChI | InChI=1S/C39H46BN6.C14H20O2.Cu/c1-25(2)31-10-16-34(17-11-31)37-22-28(7)44(41-37)40(45-29(8)23-38(42-45)35-18-12-32(13-19-35)26(3)4)46-30(9)24-39(43-46)36-20-14-33(15-21-36)27(5)6;1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9;/h10-27,40H,1-9H3;7-8H,1-6H3;/q-1;;+1 |
| InChIKey | WIQYZWHCBIXRDQ-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.51 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|