C54H48B2N18Zn — CID 139135123
Bis-Hydrotris(5-methyl-3-3'pyridyl-pyrazole-1-yl)borato-zinc (PubChem CID 139135123) has the molecular formula C54H48B2N18Zn and a molecular weight of 1036.12 g/mol.
| Compound Name | Bis-Hydrotris(5-methyl-3-3'pyridyl-pyrazole-1-yl)borato-zinc |
|---|---|
| PubChem CID | 139135123 |
| Molecular Formula | C54H48B2N18Zn |
| Molecular Weight | 1036.12 g/mol |
| Exact Mass | 1034.38 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cccnc2)nn1[B-](n1nc(-c2cccnc2)cc1C)n1nc(-c2cccnc2)cc1C.Cc1cc(-c2cccnc2)nn1[B-](n1nc(-c2cccnc2)cc1C)n1nc(-c2cccnc2)cc1C.[Zn+2] |
| InChI | InChI=1S/2C27H24BN9.Zn/c2*1-19-13-25(22-7-4-10-29-16-22)32-35(19)28(36-20(2)14-26(33-36)23-8-5-11-30-17-23)37-21(3)15-27(34-37)24-9-6-12-31-18-24;/h2*4-18H,1-3H3;/q2*-1;+2 |
| InChIKey | NFYSTKRJBVVPRU-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 184.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.12 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|