C57H49N5Zn — CID 139135149
pyridine;2,3,7,8-tetraethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139135149) has the molecular formula C57H49N5Zn and a molecular weight of 869.44 g/mol. Its IUPAC name is pyridine;2,3,7,8-tetraethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | pyridine;2,3,7,8-tetraethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139135149 |
| Molecular Formula | C57H49N5Zn |
| Molecular Weight | 869.44 g/mol |
| Exact Mass | 867.33 |
| IUPAC Name | pyridine;2,3,7,8-tetraethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | CCc1c2[n-]c(c1CC)[C+](c1ccccc1)c1[n-]c(c(CC)c1CC)[C+](c1ccccc1)c1ccc([n-]1)[C+](c1ccccc1)c1ccc([n-]1)[C+]2c1ccccc1.[Zn].c1ccncc1 |
| InChI | InChI=1S/C52H44N4.C5H5N.Zn/c1-5-37-39(7-3)51-48(36-27-19-12-20-28-36)52-40(8-4)38(6-2)50(56-52)47(35-25-17-11-18-26-35)44-32-30-42(54-44)45(33-21-13-9-14-22-33)41-29-31-43(53-41)46(49(37)55-51)34-23-15-10-16-24-34;1-2-4-6-5-3-1;/h9-32H,5-8H2,1-4H3;1-5H; |
| InChIKey | SVDPRKLJBLVRCP-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 69.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.44 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|