C56H52CuN4 — CID 139135150
copper;2,3,7,8,12,13-hexaethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide (PubChem CID 139135150) has the molecular formula C56H52CuN4 and a molecular weight of 844.61 g/mol. Its IUPAC name is copper;2,3,7,8,12,13-hexaethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide.
| Compound Name | copper;2,3,7,8,12,13-hexaethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide |
|---|---|
| PubChem CID | 139135150 |
| Molecular Formula | C56H52CuN4 |
| Molecular Weight | 844.61 g/mol |
| Exact Mass | 843.35 |
| IUPAC Name | copper;2,3,7,8,12,13-hexaethyl-5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide |
| SMILES | CCc1c2[n-]c(c1CC)[C+](c1ccccc1)c1[n-]c(c(CC)c1CC)[C+](c1ccccc1)c1[n-]c(c(CC)c1CC)[C+](c1ccccc1)c1ccc([n-]1)[C+]2c1ccccc1.[Cu] |
| InChI | InChI=1S/C56H52N4.Cu/c1-7-39-41(9-3)53-49(37-29-21-15-22-30-37)55-43(11-5)44(12-6)56(60-55)50(38-31-23-16-24-32-38)54-42(10-4)40(8-2)52(59-54)48(36-27-19-14-20-28-36)46-34-33-45(57-46)47(51(39)58-53)35-25-17-13-18-26-35;/h13-34H,7-12H2,1-6H3; |
| InChIKey | NBNSYEJKQDYLFJ-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.61 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|