About 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine
1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine (PubChem CID 139135462) has the molecular formula C16H18FN
and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine.
Molecular Properties
| Compound Name | 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine |
| PubChem CID | 139135462 |
| Molecular Formula | C16H18FN |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine |
| SMILES | CC1(C)[C@H]2CC=C(/C=N/c3ccccc3F)[C@@H]1C2 |
| InChI | InChI=1S/C16H18FN/c1-16(2)12-8-7-11(13(16)9-12)10-18-15-6-4-3-5-14(15)17/h3-7,10,12-13H,8-9H2,1-2H3/b18-10+/t12-,13-/m0/s1 |
| InChIKey | DFQPBAHIXOLTRX-RAPDUPMSSA-N |
| XLogP | 4.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine?
The IUPAC name of 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine (CID 139135462) is 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine.
What is the SMILES notation for 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine?
The canonical SMILES for 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine is CC1(C)[C@H]2CC=C(/C=N/c3ccccc3F)[C@@H]1C2.
What is the InChIKey of 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine?
The InChIKey is DFQPBAHIXOLTRX-RAPDUPMSSA-N. The full InChI is InChI=1S/C16H18FN/c1-16(2)12-8-7-11(13(16)9-12)10-18-15-6-4-3-5-14(15)17/h3-7,10,12-13H,8-9H2,1-2H3/b18-10+/t12-,13-/m0/s1.
What are the key properties of 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine?
1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine has a molecular weight of 243.33 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-N-(2-fluorophenyl)methanimine is sourced from PubChem (CID 139135462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).