About (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide
(9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide (PubChem CID 139135915) has the molecular formula C17H12NOP
and a molecular weight of 277.26 g/mol. Its IUPAC name is (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide.
Molecular Properties
| Compound Name | (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide |
| PubChem CID | 139135915 |
| Molecular Formula | C17H12NOP |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide |
| SMILES | O=[P@]1(c2ccccc2)c2ccccc2-c2cccnc21 |
| InChI | InChI=1S/C17H12NOP/c19-20(13-7-2-1-3-8-13)16-11-5-4-9-14(16)15-10-6-12-18-17(15)20/h1-12H/t20-/m1/s1 |
| InChIKey | CTBWZDMLHKAJOO-HXUWFJFHSA-N |
| XLogP | 2.70 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide?
The IUPAC name of (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide (CID 139135915) is (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide.
What is the SMILES notation for (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide?
The canonical SMILES for (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide is O=[P@]1(c2ccccc2)c2ccccc2-c2cccnc21.
What is the InChIKey of (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide?
The InChIKey is CTBWZDMLHKAJOO-HXUWFJFHSA-N. The full InChI is InChI=1S/C17H12NOP/c19-20(13-7-2-1-3-8-13)16-11-5-4-9-14(16)15-10-6-12-18-17(15)20/h1-12H/t20-/m1/s1.
What are the key properties of (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide?
(9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide has a molecular weight of 277.26 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-9-phenylphosphindolo[2,3-b]pyridine 9-oxide is sourced from PubChem (CID 139135915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).