C22H15F6NO4S+2 — CID 139136033
4-[10-ethyl-7-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenothiazine-5,10-diium-3-yl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one (PubChem CID 139136033) has the molecular formula C22H15F6NO4S+2 and a molecular weight of 503.42 g/mol. Its IUPAC name is 4-[10-ethyl-7-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenothiazine-5,10-diium-3-yl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one.
| Compound Name | 4-[10-ethyl-7-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenothiazine-5,10-diium-3-yl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 139136033 |
| Molecular Formula | C22H15F6NO4S+2 |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 4-[10-ethyl-7-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenothiazine-5,10-diium-3-yl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
| SMILES | CC[n+]1c2ccc(C(O)=CC(=O)C(F)(F)F)cc2[s+]c2cc(C(O)=CC(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H13F6NO4S/c1-2-29-13-5-3-11(15(30)9-19(32)21(23,24)25)7-17(13)34-18-8-12(4-6-14(18)29)16(31)10-20(33)22(26,27)28/h3-10H,2H2,1H3/p+2 |
| InChIKey | FSQSHPYEBNJQTH-UHFFFAOYSA-P |
| XLogP | 5.70 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|