C22H12F12N4 — CID 139136040
2-[3,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine (PubChem CID 139136040) has the molecular formula C22H12F12N4 and a molecular weight of 560.34 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine.
| Compound Name | 2-[3,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine |
|---|---|
| PubChem CID | 139136040 |
| Molecular Formula | C22H12F12N4 |
| Molecular Weight | 560.34 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(-c2ccccn2)[nH]1.FC(F)(F)c1cc(C(F)(F)F)c(-c2ccccn2)[nH]1 |
| InChI | InChI=1S/2C11H6F6N2/c2*12-10(13,14)6-5-8(11(15,16)17)19-9(6)7-3-1-2-4-18-7/h2*1-5,19H |
| InChIKey | AJIFIXCLXPDHAU-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.34 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |