C28H26NOP — CID 139136093
dibenzofuran-4-yl-methyl-phenyl-(2,4,6-trimethylphenyl)imino-λ5-phosphane (PubChem CID 139136093) has the molecular formula C28H26NOP and a molecular weight of 423.50 g/mol. Its IUPAC name is dibenzofuran-4-yl-methyl-phenyl-(2,4,6-trimethylphenyl)imino-λ5-phosphane.
| Compound Name | dibenzofuran-4-yl-methyl-phenyl-(2,4,6-trimethylphenyl)imino-λ5-phosphane |
|---|---|
| PubChem CID | 139136093 |
| Molecular Formula | C28H26NOP |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | dibenzofuran-4-yl-methyl-phenyl-(2,4,6-trimethylphenyl)imino-λ5-phosphane |
| SMILES | Cc1cc(C)c(N=[P@@](C)(c2ccccc2)c2cccc3c2oc2ccccc23)c(C)c1 |
| InChI | InChI=1S/C28H26NOP/c1-19-17-20(2)27(21(3)18-19)29-31(4,22-11-6-5-7-12-22)26-16-10-14-24-23-13-8-9-15-25(23)30-28(24)26/h5-18H,1-4H3/t31-/m0/s1 |
| InChIKey | YAZHKXRFIGFNQO-HKBQPEDESA-N |
| XLogP | 7.62 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|