C21H20N4O7 — CID 139136669
6-[[bis[(6-carboxy-2-pyridinyl)methyl]azaniumyl]methyl]pyridine-2-carboxylate;hydrate (PubChem CID 139136669) has the molecular formula C21H20N4O7 and a molecular weight of 440.41 g/mol. Its IUPAC name is 6-[[bis[(6-carboxy-2-pyridinyl)methyl]azaniumyl]methyl]pyridine-2-carboxylate;hydrate.
| Compound Name | 6-[[bis[(6-carboxy-2-pyridinyl)methyl]azaniumyl]methyl]pyridine-2-carboxylate;hydrate |
|---|---|
| PubChem CID | 139136669 |
| Molecular Formula | C21H20N4O7 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 6-[[bis[(6-carboxy-2-pyridinyl)methyl]azaniumyl]methyl]pyridine-2-carboxylate;hydrate |
| SMILES | O.O=C([O-])c1cccc(C[NH+](Cc2cccc(C(=O)O)n2)Cc2cccc(C(=O)O)n2)n1 |
| InChI | InChI=1S/C21H18N4O6.H2O/c26-19(27)16-7-1-4-13(22-16)10-25(11-14-5-2-8-17(23-14)20(28)29)12-15-6-3-9-18(24-15)21(30)31;/h1-9H,10-12H2,(H,26,27)(H,28,29)(H,30,31);1H2 |
| InChIKey | ADUWYTNCCBGDQU-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 189.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |