About (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol
(5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol (PubChem CID 139136989) has the molecular formula C48H69N3O6
and a molecular weight of 784.09 g/mol. Its IUPAC name is (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol.
Molecular Properties
| Compound Name | (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol |
| PubChem CID | 139136989 |
| Molecular Formula | C48H69N3O6 |
| Molecular Weight | 784.09 g/mol |
| Exact Mass | 783.52 |
| IUPAC Name | (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(CO)nc2c1.CC(C)(C)c1cc(C(C)(C)C)c2oc(CO)nc2c1.CC(C)(C)c1cc(C(C)(C)C)c2oc(CO)nc2c1 |
| InChI | InChI=1S/3C16H23NO2/c3*1-15(2,3)10-7-11(16(4,5)6)14-12(8-10)17-13(9-18)19-14/h3*7-8,18H,9H2,1-6H3 |
| InChIKey | NUVXTGJFWDPQCN-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 784.09 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol?
The IUPAC name of (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol (CID 139136989) is (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol.
What is the SMILES notation for (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol?
The canonical SMILES for (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol is CC(C)(C)c1cc(C(C)(C)C)c2oc(CO)nc2c1.CC(C)(C)c1cc(C(C)(C)C)c2oc(CO)nc2c1.CC(C)(C)c1cc(C(C)(C)C)c2oc(CO)nc2c1.
What is the InChIKey of (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol?
The InChIKey is NUVXTGJFWDPQCN-UHFFFAOYSA-N. The full InChI is InChI=1S/3C16H23NO2/c3*1-15(2,3)10-7-11(16(4,5)6)14-12(8-10)17-13(9-18)19-14/h3*7-8,18H,9H2,1-6H3.
What are the key properties of (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol?
(5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol has a molecular weight of 784.09 g/mol, XLogP of 11.75, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-ditert-butyl-1,3-benzoxazol-2-yl)methanol is sourced from PubChem (CID 139136989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).