C26H2BF18N4Tl — CID 139137015
bis[4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)indazol-2-yl]boranuide;thallium(1+) (PubChem CID 139137015) has the molecular formula C26H2BF18N4Tl and a molecular weight of 927.49 g/mol. Its IUPAC name is bis[4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)indazol-2-yl]boranuide;thallium(1+).
| Compound Name | bis[4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)indazol-2-yl]boranuide;thallium(1+) |
|---|---|
| PubChem CID | 139137015 |
| Molecular Formula | C26H2BF18N4Tl |
| Molecular Weight | 927.49 g/mol |
| Exact Mass | 927.98 |
| IUPAC Name | bis[4,5,6,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)indazol-2-yl]boranuide;thallium(1+) |
| SMILES | Fc1c(F)c(F)c(-c2c3c(F)c(F)c(F)c(F)c3nn2[BH2-]n2nc3c(F)c(F)c(F)c(F)c3c2-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[Tl+] |
| InChI | InChI=1S/C26H2BF18N4.Tl/c28-5-1(6(29)12(35)17(40)11(5)34)25-3-9(32)15(38)19(42)21(44)23(3)46-48(25)27-49-26(2-7(30)13(36)18(41)14(37)8(2)31)4-10(33)16(39)20(43)22(45)24(4)47-49;/h27H2;/q-1;+1 |
| InChIKey | GMOCTRJTCLYNHB-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.49 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|